C13H16O4 — CID 10847398
3-phenyl-1,2,4,5-tetraoxaspiro[5.5]undecane (PubChem CID 10847398) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-phenyl-1,2,4,5-tetraoxaspiro[5.5]undecane.
| Compound Name | 3-phenyl-1,2,4,5-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 10847398 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-phenyl-1,2,4,5-tetraoxaspiro[5.5]undecane |
| SMILES | c1ccc(C2OOC3(CCCCC3)OO2)cc1 |
| InChI | InChI=1S/C13H16O4/c1-3-7-11(8-4-1)12-14-16-13(17-15-12)9-5-2-6-10-13/h1,3-4,7-8,12H,2,5-6,9-10H2 |
| InChIKey | VXYLOOKQIGPECP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|