C14H18O2 — CID 10560784
spiro[1,5-dihydro-2,4-benzodioxepine-3,1'-cyclohexane] (PubChem CID 10560784) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is spiro[1,5-dihydro-2,4-benzodioxepine-3,1'-cyclohexane].
| Compound Name | spiro[1,5-dihydro-2,4-benzodioxepine-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 10560784 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | spiro[1,5-dihydro-2,4-benzodioxepine-3,1'-cyclohexane] |
| SMILES | c1ccc2c(c1)COC1(CCCCC1)OC2 |
| InChI | InChI=1S/C14H18O2/c1-4-8-14(9-5-1)15-10-12-6-2-3-7-13(12)11-16-14/h2-3,6-7H,1,4-5,8-11H2 |
| InChIKey | DOMDJQVUDCVBGY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |