C14H18O6 — CID 10755319
5a-hydroperoxy-9a-methyl-3-phenyl-6,7,8,9-tetrahydrobenzo[f][1,2,4,5]tetraoxepine (PubChem CID 10755319) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 5a-hydroperoxy-9a-methyl-3-phenyl-6,7,8,9-tetrahydrobenzo[f][1,2,4,5]tetraoxepine.
| Compound Name | 5a-hydroperoxy-9a-methyl-3-phenyl-6,7,8,9-tetrahydrobenzo[f][1,2,4,5]tetraoxepine |
|---|---|
| PubChem CID | 10755319 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 5a-hydroperoxy-9a-methyl-3-phenyl-6,7,8,9-tetrahydrobenzo[f][1,2,4,5]tetraoxepine |
| SMILES | CC12CCCCC1(OO)OOC(c1ccccc1)OO2 |
| InChI | InChI=1S/C14H18O6/c1-13-9-5-6-10-14(13,18-15)20-17-12(16-19-13)11-7-3-2-4-8-11/h2-4,7-8,12,15H,5-6,9-10H2,1H3 |
| InChIKey | NMDWLSTZGSQQGT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|