C15H20O2 — CID 102238187
(3aR,9aR)-2-phenyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxole (PubChem CID 102238187) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (3aR,9aR)-2-phenyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxole.
| Compound Name | (3aR,9aR)-2-phenyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxole |
|---|---|
| PubChem CID | 102238187 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (3aR,9aR)-2-phenyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxole |
| SMILES | c1ccc(C2O[C@@H]3CCCCCC[C@H]3O2)cc1 |
| InChI | InChI=1S/C15H20O2/c1-2-7-11-14-13(10-6-1)16-15(17-14)12-8-4-3-5-9-12/h3-5,8-9,13-15H,1-2,6-7,10-11H2/t13-,14-/m1/s1 |
| InChIKey | RLPCXHZPLQXGDE-ZIAGYGMSSA-N |
| XLogP | 3.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |