C15H18O3 — CID 134693339
3-hydroxy-2-phenyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one (PubChem CID 134693339) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-hydroxy-2-phenyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one.
| Compound Name | 3-hydroxy-2-phenyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
|---|---|
| PubChem CID | 134693339 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 3-hydroxy-2-phenyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
| SMILES | O=C1C(O)C(c2ccccc2)OC2CCCCC12 |
| InChI | InChI=1S/C15H18O3/c16-13-11-8-4-5-9-12(11)18-15(14(13)17)10-6-2-1-3-7-10/h1-3,6-7,11-12,14-15,17H,4-5,8-9H2 |
| InChIKey | HXVDVOIXMZWBMD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |