C14H16O2 — CID 13148720
(3R,3aR,7aS)-3-phenyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 13148720) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (3R,3aR,7aS)-3-phenyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aR,7aS)-3-phenyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 13148720 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (3R,3aR,7aS)-3-phenyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | O=C1O[C@@H](c2ccccc2)[C@@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C14H16O2/c15-14-12-9-5-4-8-11(12)13(16-14)10-6-2-1-3-7-10/h1-3,6-7,11-13H,4-5,8-9H2/t11-,12+,13+/m1/s1 |
| InChIKey | LJPBGQJJWODJLW-AGIUHOORSA-N |
| XLogP | 3.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |