C14H15BrO2 — CID 101352889
(3S,3aS,7aR)-3-(4-bromophenyl)-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 101352889) has the molecular formula C14H15BrO2 and a molecular weight of 295.18 g/mol. Its IUPAC name is (3S,3aS,7aR)-3-(4-bromophenyl)-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | (3S,3aS,7aR)-3-(4-bromophenyl)-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 101352889 |
| Molecular Formula | C14H15BrO2 |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | (3S,3aS,7aR)-3-(4-bromophenyl)-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | O=C1O[C@H](c2ccc(Br)cc2)[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C14H15BrO2/c15-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)14(16)17-13/h5-8,11-13H,1-4H2/t11-,12+,13+/m0/s1 |
| InChIKey | HSIJUASSXCZZJB-YNEHKIRRSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |