C11H11BrO2 — CID 125494033
(3R,5R)-5-(4-bromophenyl)-3-methyloxolan-2-one (PubChem CID 125494033) has the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. Its IUPAC name is (3R,5R)-5-(4-bromophenyl)-3-methyloxolan-2-one.
| Compound Name | (3R,5R)-5-(4-bromophenyl)-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 125494033 |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | (3R,5R)-5-(4-bromophenyl)-3-methyloxolan-2-one |
| SMILES | C[C@@H]1C[C@H](c2ccc(Br)cc2)OC1=O |
| InChI | InChI=1S/C11H11BrO2/c1-7-6-10(14-11(7)13)8-2-4-9(12)5-3-8/h2-5,7,10H,6H2,1H3/t7-,10-/m1/s1 |
| InChIKey | ZHGJGEUXGIDFNX-GMSGAONNSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |