C19H17BrO2S — CID 122395201
S-methyl (2S,4R)-2-(4-bromophenyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carbothioate (PubChem CID 122395201) has the molecular formula C19H17BrO2S and a molecular weight of 389.31 g/mol. Its IUPAC name is S-methyl (2S,4R)-2-(4-bromophenyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carbothioate.
| Compound Name | S-methyl (2S,4R)-2-(4-bromophenyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carbothioate |
|---|---|
| PubChem CID | 122395201 |
| Molecular Formula | C19H17BrO2S |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | S-methyl (2S,4R)-2-(4-bromophenyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carbothioate |
| SMILES | CSC(=O)C1=C[C@H](c2ccccc2)C[C@@H](c2ccc(Br)cc2)O1 |
| InChI | InChI=1S/C19H17BrO2S/c1-23-19(21)18-12-15(13-5-3-2-4-6-13)11-17(22-18)14-7-9-16(20)10-8-14/h2-10,12,15,17H,11H2,1H3/t15-,17+/m1/s1 |
| InChIKey | VAMUUTHULYNURB-WBVHZDCISA-N |
| XLogP | 5.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|