C17H14BrNO3 — CID 102525271
N-[(3R,5R)-5-(4-bromophenyl)-2-oxooxolan-3-yl]benzamide (PubChem CID 102525271) has the molecular formula C17H14BrNO3 and a molecular weight of 360.21 g/mol. Its IUPAC name is N-[(3R,5R)-5-(4-bromophenyl)-2-oxooxolan-3-yl]benzamide.
| Compound Name | N-[(3R,5R)-5-(4-bromophenyl)-2-oxooxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 102525271 |
| Molecular Formula | C17H14BrNO3 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | N-[(3R,5R)-5-(4-bromophenyl)-2-oxooxolan-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1C[C@H](c2ccc(Br)cc2)OC1=O)c1ccccc1 |
| InChI | InChI=1S/C17H14BrNO3/c18-13-8-6-11(7-9-13)15-10-14(17(21)22-15)19-16(20)12-4-2-1-3-5-12/h1-9,14-15H,10H2,(H,19,20)/t14-,15-/m1/s1 |
| InChIKey | LFIQEGCGTXCXNU-HUUCEWRRSA-N |
| XLogP | 3.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |