C17H15NO3 — CID 102525266
N-[(3S,5S)-2-oxo-5-phenyloxolan-3-yl]benzamide (PubChem CID 102525266) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[(3S,5S)-2-oxo-5-phenyloxolan-3-yl]benzamide.
| Compound Name | N-[(3S,5S)-2-oxo-5-phenyloxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 102525266 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-[(3S,5S)-2-oxo-5-phenyloxolan-3-yl]benzamide |
| SMILES | O=C(N[C@H]1C[C@@H](c2ccccc2)OC1=O)c1ccccc1 |
| InChI | InChI=1S/C17H15NO3/c19-16(13-9-5-2-6-10-13)18-14-11-15(21-17(14)20)12-7-3-1-4-8-12/h1-10,14-15H,11H2,(H,18,19)/t14-,15-/m0/s1 |
| InChIKey | WDAXSQRHVZGTQI-GJZGRUSLSA-N |
| XLogP | 2.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |