C20H18N2O4 — CID 7831985
N-[(3R,4aR,10bS)-7-methyl-2,5-dioxo-4,4a,6,10b-tetrahydro-3H-pyrano[3,2-c]quinolin-3-yl]benzamide (PubChem CID 7831985) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is N-[(3R,4aR,10bS)-7-methyl-2,5-dioxo-4,4a,6,10b-tetrahydro-3H-pyrano[3,2-c]quinolin-3-yl]benzamide.
| Compound Name | N-[(3R,4aR,10bS)-7-methyl-2,5-dioxo-4,4a,6,10b-tetrahydro-3H-pyrano[3,2-c]quinolin-3-yl]benzamide |
|---|---|
| PubChem CID | 7831985 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[(3R,4aR,10bS)-7-methyl-2,5-dioxo-4,4a,6,10b-tetrahydro-3H-pyrano[3,2-c]quinolin-3-yl]benzamide |
| SMILES | Cc1cccc2c1NC(=O)[C@@H]1C[C@@H](NC(=O)c3ccccc3)C(=O)O[C@H]21 |
| InChI | InChI=1S/C20H18N2O4/c1-11-6-5-9-13-16(11)22-19(24)14-10-15(20(25)26-17(13)14)21-18(23)12-7-3-2-4-8-12/h2-9,14-15,17H,10H2,1H3,(H,21,23)(H,22,24)/t14-,15-,17-/m1/s1 |
| InChIKey | QHSAXOQLOCXRTL-BFYDXBDKSA-N |
| XLogP | 2.35 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |