C15H14N2O — CID 114996622
3-anilino-7-methyl-1,3-dihydroindol-2-one (PubChem CID 114996622) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-anilino-7-methyl-1,3-dihydroindol-2-one.
| Compound Name | 3-anilino-7-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 114996622 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-anilino-7-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1cccc2c1NC(=O)C2Nc1ccccc1 |
| InChI | InChI=1S/C15H14N2O/c1-10-6-5-9-12-13(10)17-15(18)14(12)16-11-7-3-2-4-8-11/h2-9,14,16H,1H3,(H,17,18) |
| InChIKey | GZMFQHRMUZXYCM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |