C11H15N3O — CID 82236321
3-(2-aminoethylamino)-7-methyl-1,3-dihydroindol-2-one (PubChem CID 82236321) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-(2-aminoethylamino)-7-methyl-1,3-dihydroindol-2-one.
| Compound Name | 3-(2-aminoethylamino)-7-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82236321 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 3-(2-aminoethylamino)-7-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1cccc2c1NC(=O)C2NCCN |
| InChI | InChI=1S/C11H15N3O/c1-7-3-2-4-8-9(7)14-11(15)10(8)13-6-5-12/h2-4,10,13H,5-6,12H2,1H3,(H,14,15) |
| InChIKey | MJRMTSWXUAOASG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |