C16H14BrNO — CID 98160364
(3R)-3-[(2-bromophenyl)methyl]-7-methyl-1,3-dihydroindol-2-one (PubChem CID 98160364) has the molecular formula C16H14BrNO and a molecular weight of 316.20 g/mol. Its IUPAC name is (3R)-3-[(2-bromophenyl)methyl]-7-methyl-1,3-dihydroindol-2-one.
| Compound Name | (3R)-3-[(2-bromophenyl)methyl]-7-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 98160364 |
| Molecular Formula | C16H14BrNO |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (3R)-3-[(2-bromophenyl)methyl]-7-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1cccc2c1NC(=O)[C@@H]2Cc1ccccc1Br |
| InChI | InChI=1S/C16H14BrNO/c1-10-5-4-7-12-13(16(19)18-15(10)12)9-11-6-2-3-8-14(11)17/h2-8,13H,9H2,1H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | ZUMKJCSCQXAXKL-CYBMUJFWSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |