C17H23NO — CID 106987031
3-(2-cyclohexylethyl)-7-methyl-1,3-dihydroindol-2-one (PubChem CID 106987031) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 3-(2-cyclohexylethyl)-7-methyl-1,3-dihydroindol-2-one.
| Compound Name | 3-(2-cyclohexylethyl)-7-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106987031 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 3-(2-cyclohexylethyl)-7-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1cccc2c1NC(=O)C2CCC1CCCCC1 |
| InChI | InChI=1S/C17H23NO/c1-12-6-5-9-14-15(17(19)18-16(12)14)11-10-13-7-3-2-4-8-13/h5-6,9,13,15H,2-4,7-8,10-11H2,1H3,(H,18,19) |
| InChIKey | RXHJWKUXPOQPNM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |