C16H20FNO — CID 106987028
3-(2-cyclohexylethyl)-7-fluoro-1,3-dihydroindol-2-one (PubChem CID 106987028) has the molecular formula C16H20FNO and a molecular weight of 261.34 g/mol. Its IUPAC name is 3-(2-cyclohexylethyl)-7-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-(2-cyclohexylethyl)-7-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106987028 |
| Molecular Formula | C16H20FNO |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-(2-cyclohexylethyl)-7-fluoro-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2c(F)cccc2C1CCC1CCCCC1 |
| InChI | InChI=1S/C16H20FNO/c17-14-8-4-7-12-13(16(19)18-15(12)14)10-9-11-5-2-1-3-6-11/h4,7-8,11,13H,1-3,5-6,9-10H2,(H,18,19) |
| InChIKey | MHSKPOLXHYFEAN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |