C16H22FNO — CID 106820157
7-fluoro-3-octyl-1,3-dihydroindol-2-one (PubChem CID 106820157) has the molecular formula C16H22FNO and a molecular weight of 263.36 g/mol. Its IUPAC name is 7-fluoro-3-octyl-1,3-dihydroindol-2-one.
| Compound Name | 7-fluoro-3-octyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106820157 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 7-fluoro-3-octyl-1,3-dihydroindol-2-one |
| SMILES | CCCCCCCCC1C(=O)Nc2c(F)cccc21 |
| InChI | InChI=1S/C16H22FNO/c1-2-3-4-5-6-7-9-13-12-10-8-11-14(17)15(12)18-16(13)19/h8,10-11,13H,2-7,9H2,1H3,(H,18,19) |
| InChIKey | RMHAULPXVIHCMA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|