About 7-fluoro-3-octyl-1,3-dihydroindol-2-one
7-fluoro-3-octyl-1,3-dihydroindol-2-one (PubChem CID 106820157) has the molecular formula C16H22FNO
and a molecular weight of 263.36 g/mol. Its IUPAC name is 7-fluoro-3-octyl-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 7-fluoro-3-octyl-1,3-dihydroindol-2-one |
| PubChem CID | 106820157 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 7-fluoro-3-octyl-1,3-dihydroindol-2-one |
| SMILES | CCCCCCCCC1C(=O)Nc2c(F)cccc21 |
| InChI | InChI=1S/C16H22FNO/c1-2-3-4-5-6-7-9-13-12-10-8-11-14(17)15(12)18-16(13)19/h8,10-11,13H,2-7,9H2,1H3,(H,18,19) |
| InChIKey | RMHAULPXVIHCMA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-3-octyl-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-3-octyl-1,3-dihydroindol-2-one?
The IUPAC name of 7-fluoro-3-octyl-1,3-dihydroindol-2-one (CID 106820157) is 7-fluoro-3-octyl-1,3-dihydroindol-2-one.
What is the SMILES notation for 7-fluoro-3-octyl-1,3-dihydroindol-2-one?
The canonical SMILES for 7-fluoro-3-octyl-1,3-dihydroindol-2-one is CCCCCCCCC1C(=O)Nc2c(F)cccc21.
What is the InChIKey of 7-fluoro-3-octyl-1,3-dihydroindol-2-one?
The InChIKey is RMHAULPXVIHCMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22FNO/c1-2-3-4-5-6-7-9-13-12-10-8-11-14(17)15(12)18-16(13)19/h8,10-11,13H,2-7,9H2,1H3,(H,18,19).
What are the key properties of 7-fluoro-3-octyl-1,3-dihydroindol-2-one?
7-fluoro-3-octyl-1,3-dihydroindol-2-one has a molecular weight of 263.36 g/mol, XLogP of 4.61, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-3-octyl-1,3-dihydroindol-2-one is sourced from PubChem (CID 106820157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).