C16H21F2NO2 — CID 106987093
5-(difluoromethoxy)-3-heptyl-1,3-dihydroindol-2-one (PubChem CID 106987093) has the molecular formula C16H21F2NO2 and a molecular weight of 297.34 g/mol. Its IUPAC name is 5-(difluoromethoxy)-3-heptyl-1,3-dihydroindol-2-one.
| Compound Name | 5-(difluoromethoxy)-3-heptyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106987093 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 5-(difluoromethoxy)-3-heptyl-1,3-dihydroindol-2-one |
| SMILES | CCCCCCCC1C(=O)Nc2ccc(OC(F)F)cc21 |
| InChI | InChI=1S/C16H21F2NO2/c1-2-3-4-5-6-7-12-13-10-11(21-16(17)18)8-9-14(13)19-15(12)20/h8-10,12,16H,2-7H2,1H3,(H,19,20) |
| InChIKey | LLDILBBJVATZSQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|