C15H21NO — CID 106986527
5-tert-butyl-3-propyl-1,3-dihydroindol-2-one (PubChem CID 106986527) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 5-tert-butyl-3-propyl-1,3-dihydroindol-2-one.
| Compound Name | 5-tert-butyl-3-propyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106986527 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 5-tert-butyl-3-propyl-1,3-dihydroindol-2-one |
| SMILES | CCCC1C(=O)Nc2ccc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C15H21NO/c1-5-6-11-12-9-10(15(2,3)4)7-8-13(12)16-14(11)17/h7-9,11H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | RMJUNSUBZCTDSG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |