C17H24FNO — CID 106987039
5-fluoro-3-nonyl-1,3-dihydroindol-2-one (PubChem CID 106987039) has the molecular formula C17H24FNO and a molecular weight of 277.38 g/mol. Its IUPAC name is 5-fluoro-3-nonyl-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-3-nonyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106987039 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 5-fluoro-3-nonyl-1,3-dihydroindol-2-one |
| SMILES | CCCCCCCCCC1C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C17H24FNO/c1-2-3-4-5-6-7-8-9-14-15-12-13(18)10-11-16(15)19-17(14)20/h10-12,14H,2-9H2,1H3,(H,19,20) |
| InChIKey | UNUBVLDLRIXRIM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|