About 5-fluoro-3-nonyl-1,3-dihydroindol-2-one
5-fluoro-3-nonyl-1,3-dihydroindol-2-one (PubChem CID 106987039) has the molecular formula C17H24FNO
and a molecular weight of 277.38 g/mol. Its IUPAC name is 5-fluoro-3-nonyl-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-fluoro-3-nonyl-1,3-dihydroindol-2-one |
| PubChem CID | 106987039 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 5-fluoro-3-nonyl-1,3-dihydroindol-2-one |
| SMILES | CCCCCCCCCC1C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C17H24FNO/c1-2-3-4-5-6-7-8-9-14-15-12-13(18)10-11-16(15)19-17(14)20/h10-12,14H,2-9H2,1H3,(H,19,20) |
| InChIKey | UNUBVLDLRIXRIM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-3-nonyl-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-nonyl-1,3-dihydroindol-2-one?
The IUPAC name of 5-fluoro-3-nonyl-1,3-dihydroindol-2-one (CID 106987039) is 5-fluoro-3-nonyl-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-fluoro-3-nonyl-1,3-dihydroindol-2-one?
The canonical SMILES for 5-fluoro-3-nonyl-1,3-dihydroindol-2-one is CCCCCCCCCC1C(=O)Nc2ccc(F)cc21.
What is the InChIKey of 5-fluoro-3-nonyl-1,3-dihydroindol-2-one?
The InChIKey is UNUBVLDLRIXRIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24FNO/c1-2-3-4-5-6-7-8-9-14-15-12-13(18)10-11-16(15)19-17(14)20/h10-12,14H,2-9H2,1H3,(H,19,20).
What are the key properties of 5-fluoro-3-nonyl-1,3-dihydroindol-2-one?
5-fluoro-3-nonyl-1,3-dihydroindol-2-one has a molecular weight of 277.38 g/mol, XLogP of 5.00, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-nonyl-1,3-dihydroindol-2-one is sourced from PubChem (CID 106987039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).