C9H8FNO2 — CID 131358029
5-fluoro-3-(hydroxymethyl)-1,3-dihydroindol-2-one (PubChem CID 131358029) has the molecular formula C9H8FNO2 and a molecular weight of 181.17 g/mol. Its IUPAC name is 5-fluoro-3-(hydroxymethyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-3-(hydroxymethyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 131358029 |
| Molecular Formula | C9H8FNO2 |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 5-fluoro-3-(hydroxymethyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C1CO |
| InChI | InChI=1S/C9H8FNO2/c10-5-1-2-8-6(3-5)7(4-12)9(13)11-8/h1-3,7,12H,4H2,(H,11,13) |
| InChIKey | BLHCFEXDELQVBD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |