C12H14FNO — CID 106986875
3-tert-butyl-5-fluoro-1,3-dihydroindol-2-one (PubChem CID 106986875) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is 3-tert-butyl-5-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-tert-butyl-5-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106986875 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 3-tert-butyl-5-fluoro-1,3-dihydroindol-2-one |
| SMILES | CC(C)(C)C1C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C12H14FNO/c1-12(2,3)10-8-6-7(13)4-5-9(8)14-11(10)15/h4-6,10H,1-3H3,(H,14,15) |
| InChIKey | PKJZDYFAKIXWRY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |