C9H9FN2O — CID 15337296
7-fluoro-3-methyl-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 15337296) has the molecular formula C9H9FN2O and a molecular weight of 180.18 g/mol. Its IUPAC name is 7-fluoro-3-methyl-3,4-dihydro-1H-quinoxalin-2-one.
| Compound Name | 7-fluoro-3-methyl-3,4-dihydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 15337296 |
| Molecular Formula | C9H9FN2O |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 7-fluoro-3-methyl-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | CC1Nc2ccc(F)cc2NC1=O |
| InChI | InChI=1S/C9H9FN2O/c1-5-9(13)12-8-4-6(10)2-3-7(8)11-5/h2-5,11H,1H3,(H,12,13) |
| InChIKey | ZXGDQNLIAUXOLE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |