C15H18FNO — CID 106986680
5-fluoro-3-(4-methylcyclohexyl)-1,3-dihydroindol-2-one (PubChem CID 106986680) has the molecular formula C15H18FNO and a molecular weight of 247.31 g/mol. Its IUPAC name is 5-fluoro-3-(4-methylcyclohexyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-3-(4-methylcyclohexyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106986680 |
| Molecular Formula | C15H18FNO |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 5-fluoro-3-(4-methylcyclohexyl)-1,3-dihydroindol-2-one |
| SMILES | CC1CCC(C2C(=O)Nc3ccc(F)cc32)CC1 |
| InChI | InChI=1S/C15H18FNO/c1-9-2-4-10(5-3-9)14-12-8-11(16)6-7-13(12)17-15(14)18/h6-10,14H,2-5H2,1H3,(H,17,18) |
| InChIKey | AHMAJZPBAOKFCE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |