C13H16FNO — CID 106986781
5-fluoro-3-(3-methylbutan-2-yl)-1,3-dihydroindol-2-one (PubChem CID 106986781) has the molecular formula C13H16FNO and a molecular weight of 221.27 g/mol. Its IUPAC name is 5-fluoro-3-(3-methylbutan-2-yl)-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-3-(3-methylbutan-2-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106986781 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5-fluoro-3-(3-methylbutan-2-yl)-1,3-dihydroindol-2-one |
| SMILES | CC(C)C(C)C1C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C13H16FNO/c1-7(2)8(3)12-10-6-9(14)4-5-11(10)15-13(12)16/h4-8,12H,1-3H3,(H,15,16) |
| InChIKey | BOUJQLUJRCBELK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |