C8H5BrFNO — CID 102193435
3-bromo-5-fluoro-1,3-dihydroindol-2-one (PubChem CID 102193435) has the molecular formula C8H5BrFNO and a molecular weight of 230.04 g/mol. Its IUPAC name is 3-bromo-5-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-bromo-5-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 102193435 |
| Molecular Formula | C8H5BrFNO |
| Molecular Weight | 230.04 g/mol |
| Exact Mass | 228.95 |
| IUPAC Name | 3-bromo-5-fluoro-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C1Br |
| InChI | InChI=1S/C8H5BrFNO/c9-7-5-3-4(10)1-2-6(5)11-8(7)12/h1-3,7H,(H,11,12) |
| InChIKey | IPBLIIFDCKEZTC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.04 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|