C13H17NO2 — CID 103846259
3-butyl-5-methoxy-1,3-dihydroindol-2-one (PubChem CID 103846259) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-butyl-5-methoxy-1,3-dihydroindol-2-one.
| Compound Name | 3-butyl-5-methoxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 103846259 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-butyl-5-methoxy-1,3-dihydroindol-2-one |
| SMILES | CCCCC1C(=O)Nc2ccc(OC)cc21 |
| InChI | InChI=1S/C13H17NO2/c1-3-4-5-10-11-8-9(16-2)6-7-12(11)14-13(10)15/h6-8,10H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | HUPDPZKLLUAYMN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |