C17H22N2O2S — CID 3512324
5-heptyl-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 3512324) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is 5-heptyl-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-heptyl-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 3512324 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 5-heptyl-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCCCCCC1C(=O)NC(=S)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H22N2O2S/c1-2-3-4-5-9-12-14-15(20)18-17(22)19(16(14)21)13-10-7-6-8-11-13/h6-8,10-11,14H,2-5,9,12H2,1H3,(H,18,20,22) |
| InChIKey | ZSXZZWYHIBKTNV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|