C10H11FN2O — CID 82401385
5-amino-9-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 82401385) has the molecular formula C10H11FN2O and a molecular weight of 194.21 g/mol. Its IUPAC name is 5-amino-9-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 5-amino-9-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 82401385 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-amino-9-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | NC1CCC(=O)Nc2c(F)cccc21 |
| InChI | InChI=1S/C10H11FN2O/c11-7-3-1-2-6-8(12)4-5-9(14)13-10(6)7/h1-3,8H,4-5,12H2,(H,13,14) |
| InChIKey | KUBYZZFZTBPZPC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |