C18H17BrO — CID 164673807
(1R)-1-[(2-bromophenyl)methyl]-3,3-dimethyl-1H-inden-2-one (PubChem CID 164673807) has the molecular formula C18H17BrO and a molecular weight of 329.24 g/mol. Its IUPAC name is (1R)-1-[(2-bromophenyl)methyl]-3,3-dimethyl-1H-inden-2-one.
| Compound Name | (1R)-1-[(2-bromophenyl)methyl]-3,3-dimethyl-1H-inden-2-one |
|---|---|
| PubChem CID | 164673807 |
| Molecular Formula | C18H17BrO |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | (1R)-1-[(2-bromophenyl)methyl]-3,3-dimethyl-1H-inden-2-one |
| SMILES | CC1(C)C(=O)[C@H](Cc2ccccc2Br)c2ccccc21 |
| InChI | InChI=1S/C18H17BrO/c1-18(2)15-9-5-4-8-13(15)14(17(18)20)11-12-7-3-6-10-16(12)19/h3-10,14H,11H2,1-2H3/t14-/m1/s1 |
| InChIKey | UXXHXLAMEAPQTC-CQSZACIVSA-N |
| XLogP | 4.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |