C18H18BrNO4S — CID 167615612
benzenesulfinate;(3Z,4R)-4-[(2-bromophenyl)methyl]-3-ethylidene-1,3-oxazolidin-3-ium-2-one (PubChem CID 167615612) has the molecular formula C18H18BrNO4S and a molecular weight of 424.32 g/mol. Its IUPAC name is benzenesulfinate;(3Z,4R)-4-[(2-bromophenyl)methyl]-3-ethylidene-1,3-oxazolidin-3-ium-2-one.
| Compound Name | benzenesulfinate;(3Z,4R)-4-[(2-bromophenyl)methyl]-3-ethylidene-1,3-oxazolidin-3-ium-2-one |
|---|---|
| PubChem CID | 167615612 |
| Molecular Formula | C18H18BrNO4S |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | benzenesulfinate;(3Z,4R)-4-[(2-bromophenyl)methyl]-3-ethylidene-1,3-oxazolidin-3-ium-2-one |
| SMILES | C/C=[N+]1\C(=O)OC[C@H]1Cc1ccccc1Br.O=S([O-])c1ccccc1 |
| InChI | InChI=1S/C12H13BrNO2.C6H6O2S/c1-2-14-10(8-16-12(14)15)7-9-5-3-4-6-11(9)13;7-9(8)6-4-2-1-3-5-6/h2-6,10H,7-8H2,1H3;1-5H,(H,7,8)/q+1;/p-1/b14-2-;/t10-;/m1./s1 |
| InChIKey | LRROWWZLFLQVJL-LYZHPDANSA-M |
| XLogP | 3.54 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|