C10H11BrO2 — CID 2756954
2-[(2-bromophenyl)methyl]-1,3-dioxolane (PubChem CID 2756954) has the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methyl]-1,3-dioxolane.
| Compound Name | 2-[(2-bromophenyl)methyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 2756954 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 2-[(2-bromophenyl)methyl]-1,3-dioxolane |
| SMILES | Brc1ccccc1CC1OCCO1 |
| InChI | InChI=1S/C10H11BrO2/c11-9-4-2-1-3-8(9)7-10-12-5-6-13-10/h1-4,10H,5-7H2 |
| InChIKey | YWFSTIQYCXISNY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |