About sodium 2-bromobenzenesulfinate
sodium 2-bromobenzenesulfinate (PubChem CID 23721879) has the molecular formula C6H4BrNaO2S
and a molecular weight of 243.06 g/mol. Its IUPAC name is sodium 2-bromobenzenesulfinate.
Molecular Properties
| Compound Name | sodium 2-bromobenzenesulfinate |
| PubChem CID | 23721879 |
| Molecular Formula | C6H4BrNaO2S |
| Molecular Weight | 243.06 g/mol |
| Exact Mass | 241.90 |
| IUPAC Name | sodium 2-bromobenzenesulfinate |
| SMILES | O=S([O-])c1ccccc1Br.[Na+] |
| InChI | InChI=1S/C6H5BrO2S.Na/c7-5-3-1-2-4-6(5)10(8)9;/h1-4H,(H,8,9);/q;+1/p-1 |
| InChIKey | DTXQJIIXTBYZFM-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.06 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-bromobenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-bromobenzenesulfinate?
The IUPAC name of sodium 2-bromobenzenesulfinate (CID 23721879) is sodium 2-bromobenzenesulfinate.
What is the SMILES notation for sodium 2-bromobenzenesulfinate?
The canonical SMILES for sodium 2-bromobenzenesulfinate is O=S([O-])c1ccccc1Br.[Na+].
What is the InChIKey of sodium 2-bromobenzenesulfinate?
The InChIKey is DTXQJIIXTBYZFM-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5BrO2S.Na/c7-5-3-1-2-4-6(5)10(8)9;/h1-4H,(H,8,9);/q;+1/p-1.
What are the key properties of sodium 2-bromobenzenesulfinate?
sodium 2-bromobenzenesulfinate has a molecular weight of 243.06 g/mol, XLogP of -1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-bromobenzenesulfinate is sourced from PubChem (CID 23721879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).