About sodium 2-propylbenzenesulfinate
sodium 2-propylbenzenesulfinate (PubChem CID 23668103) has the molecular formula C9H11NaO2S
and a molecular weight of 206.24 g/mol. Its IUPAC name is sodium 2-propylbenzenesulfinate.
Molecular Properties
| Compound Name | sodium 2-propylbenzenesulfinate |
| PubChem CID | 23668103 |
| Molecular Formula | C9H11NaO2S |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | sodium 2-propylbenzenesulfinate |
| SMILES | CCCc1ccccc1S(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H12O2S.Na/c1-2-5-8-6-3-4-7-9(8)12(10)11;/h3-4,6-7H,2,5H2,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | MZUYRTBFBIFVMS-UHFFFAOYSA-M |
| XLogP | -1.12 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-propylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-propylbenzenesulfinate?
The IUPAC name of sodium 2-propylbenzenesulfinate (CID 23668103) is sodium 2-propylbenzenesulfinate.
What is the SMILES notation for sodium 2-propylbenzenesulfinate?
The canonical SMILES for sodium 2-propylbenzenesulfinate is CCCc1ccccc1S(=O)[O-].[Na+].
What is the InChIKey of sodium 2-propylbenzenesulfinate?
The InChIKey is MZUYRTBFBIFVMS-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H12O2S.Na/c1-2-5-8-6-3-4-7-9(8)12(10)11;/h3-4,6-7H,2,5H2,1H3,(H,10,11);/q;+1/p-1.
What are the key properties of sodium 2-propylbenzenesulfinate?
sodium 2-propylbenzenesulfinate has a molecular weight of 206.24 g/mol, XLogP of -1.12, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-propylbenzenesulfinate is sourced from PubChem (CID 23668103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).