About 2-dodecylbenzenesulfinic acid
2-dodecylbenzenesulfinic acid (PubChem CID 15610301) has the molecular formula C18H30O2S
and a molecular weight of 310.50 g/mol. Its IUPAC name is 2-dodecylbenzenesulfinic acid.
Molecular Properties
| Compound Name | 2-dodecylbenzenesulfinic acid |
| PubChem CID | 15610301 |
| Molecular Formula | C18H30O2S |
| Molecular Weight | 310.50 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 2-dodecylbenzenesulfinic acid |
| SMILES | CCCCCCCCCCCCc1ccccc1S(=O)O |
| InChI | InChI=1S/C18H30O2S/c1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-18(17)21(19)20/h12-13,15-16H,2-11,14H2,1H3,(H,19,20) |
| InChIKey | ZYTLBGZACQWGKA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-dodecylbenzenesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dodecylbenzenesulfinic acid?
The IUPAC name of 2-dodecylbenzenesulfinic acid (CID 15610301) is 2-dodecylbenzenesulfinic acid.
What is the SMILES notation for 2-dodecylbenzenesulfinic acid?
The canonical SMILES for 2-dodecylbenzenesulfinic acid is CCCCCCCCCCCCc1ccccc1S(=O)O.
What is the InChIKey of 2-dodecylbenzenesulfinic acid?
The InChIKey is ZYTLBGZACQWGKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O2S/c1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-18(17)21(19)20/h12-13,15-16H,2-11,14H2,1H3,(H,19,20).
What are the key properties of 2-dodecylbenzenesulfinic acid?
2-dodecylbenzenesulfinic acid has a molecular weight of 310.50 g/mol, XLogP of 5.73, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dodecylbenzenesulfinic acid is sourced from PubChem (CID 15610301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).