About [bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane
[bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane (PubChem CID 173067914) has the molecular formula C30H49O2PS2
and a molecular weight of 536.83 g/mol. Its IUPAC name is [bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane.
Molecular Properties
| Compound Name | [bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane |
| PubChem CID | 173067914 |
| Molecular Formula | C30H49O2PS2 |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | [bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane |
| SMILES | CCCCCCCCCc1ccccc1S(c1ccccc1CCCCCCCCC)=P(O)(O)S |
| InChI | InChI=1S/C30H49O2PS2/c1-3-5-7-9-11-13-15-21-27-23-17-19-25-29(27)35(33(31,32)34)30-26-20-18-24-28(30)22-16-14-12-10-8-6-4-2/h17-20,23-26,31-32,34H,3-16,21-22H2,1-2H3 |
| InChIKey | DMKUHAYPNZPQNI-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane?
The IUPAC name of [bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane (CID 173067914) is [bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane.
What is the SMILES notation for [bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane?
The canonical SMILES for [bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane is CCCCCCCCCc1ccccc1S(c1ccccc1CCCCCCCCC)=P(O)(O)S.
What is the InChIKey of [bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane?
The InChIKey is DMKUHAYPNZPQNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H49O2PS2/c1-3-5-7-9-11-13-15-21-27-23-17-19-25-29(27)35(33(31,32)34)30-26-20-18-24-28(30)22-16-14-12-10-8-6-4-2/h17-20,23-26,31-32,34H,3-16,21-22H2,1-2H3.
What are the key properties of [bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane?
[bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane has a molecular weight of 536.83 g/mol, XLogP of 9.90, 18 rotatable bonds, 3 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [bis(2-nonylphenyl)-λ4-sulfanylidene]-dihydroxy-sulfanyl-λ5-phosphane is sourced from PubChem (CID 173067914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).