About sodium 2-ethylbenzenesulfinate
sodium 2-ethylbenzenesulfinate (PubChem CID 70592875) has the molecular formula C8H9NaO2S
and a molecular weight of 192.22 g/mol. Its IUPAC name is sodium 2-ethylbenzenesulfinate.
Molecular Properties
| Compound Name | sodium 2-ethylbenzenesulfinate |
| PubChem CID | 70592875 |
| Molecular Formula | C8H9NaO2S |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | sodium 2-ethylbenzenesulfinate |
| SMILES | CCc1ccccc1S(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H10O2S.Na/c1-2-7-5-3-4-6-8(7)11(9)10;/h3-6H,2H2,1H3,(H,9,10);/q;+1/p-1 |
| InChIKey | IROADWLXCRGCTM-UHFFFAOYSA-M |
| XLogP | -1.51 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-ethylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-ethylbenzenesulfinate?
The IUPAC name of sodium 2-ethylbenzenesulfinate (CID 70592875) is sodium 2-ethylbenzenesulfinate.
What is the SMILES notation for sodium 2-ethylbenzenesulfinate?
The canonical SMILES for sodium 2-ethylbenzenesulfinate is CCc1ccccc1S(=O)[O-].[Na+].
What is the InChIKey of sodium 2-ethylbenzenesulfinate?
The InChIKey is IROADWLXCRGCTM-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10O2S.Na/c1-2-7-5-3-4-6-8(7)11(9)10;/h3-6H,2H2,1H3,(H,9,10);/q;+1/p-1.
What are the key properties of sodium 2-ethylbenzenesulfinate?
sodium 2-ethylbenzenesulfinate has a molecular weight of 192.22 g/mol, XLogP of -1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-ethylbenzenesulfinate is sourced from PubChem (CID 70592875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).