About dibenzofuran-4-sulfinate
dibenzofuran-4-sulfinate (PubChem CID 20739354) has the molecular formula C12H7O3S-
and a molecular weight of 231.25 g/mol. Its IUPAC name is dibenzofuran-4-sulfinate.
Molecular Properties
| Compound Name | dibenzofuran-4-sulfinate |
| PubChem CID | 20739354 |
| Molecular Formula | C12H7O3S- |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | dibenzofuran-4-sulfinate |
| SMILES | O=S([O-])c1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C12H8O3S/c13-16(14)11-7-3-5-9-8-4-1-2-6-10(8)15-12(9)11/h1-7H,(H,13,14)/p-1 |
| InChIKey | BGZAZYZINJQYGT-UHFFFAOYSA-M |
| XLogP | 2.82 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze dibenzofuran-4-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran-4-sulfinate?
The IUPAC name of dibenzofuran-4-sulfinate (CID 20739354) is dibenzofuran-4-sulfinate.
What is the SMILES notation for dibenzofuran-4-sulfinate?
The canonical SMILES for dibenzofuran-4-sulfinate is O=S([O-])c1cccc2c1oc1ccccc12.
What is the InChIKey of dibenzofuran-4-sulfinate?
The InChIKey is BGZAZYZINJQYGT-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H8O3S/c13-16(14)11-7-3-5-9-8-4-1-2-6-10(8)15-12(9)11/h1-7H,(H,13,14)/p-1.
What are the key properties of dibenzofuran-4-sulfinate?
dibenzofuran-4-sulfinate has a molecular weight of 231.25 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran-4-sulfinate is sourced from PubChem (CID 20739354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).