About CID 131879231
CID 131879231 (PubChem CID 131879231) has the molecular formula C12H8NaO4S
and a molecular weight of 271.25 g/mol.
Molecular Properties
| Compound Name | CID 131879231 |
| PubChem CID | 131879231 |
| Molecular Formula | C12H8NaO4S |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cccc2c1oc1ccccc12.[Na] |
| InChI | InChI=1S/C12H8O4S.Na/c13-17(14,15)11-7-3-5-9-8-4-1-2-6-10(8)16-12(9)11;/h1-7H,(H,13,14,15); |
| InChIKey | UTEDBWYKRCCSTA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 131879231 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131879231?
The IUPAC name of CID 131879231 (CID 131879231) is not available.
What is the SMILES notation for CID 131879231?
The canonical SMILES for CID 131879231 is O=S(=O)(O)c1cccc2c1oc1ccccc12.[Na].
What is the InChIKey of CID 131879231?
The InChIKey is UTEDBWYKRCCSTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O4S.Na/c13-17(14,15)11-7-3-5-9-8-4-1-2-6-10(8)16-12(9)11;/h1-7H,(H,13,14,15);.
What are the key properties of CID 131879231?
CID 131879231 has a molecular weight of 271.25 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131879231 is sourced from PubChem (CID 131879231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).