C11H12N2O3 — CID 22561655
N-(3-oxooxazinan-4-yl)benzamide (PubChem CID 22561655) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-(3-oxooxazinan-4-yl)benzamide.
| Compound Name | N-(3-oxooxazinan-4-yl)benzamide |
|---|---|
| PubChem CID | 22561655 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-(3-oxooxazinan-4-yl)benzamide |
| SMILES | O=C(NC1CCONC1=O)c1ccccc1 |
| InChI | InChI=1S/C11H12N2O3/c14-10(8-4-2-1-3-5-8)12-9-6-7-16-13-11(9)15/h1-5,9H,6-7H2,(H,12,14)(H,13,15) |
| InChIKey | ZDSIDBYXFOGZJI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |