About benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium
benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium (PubChem CID 162437723) has the molecular formula C17H17N2O2Y-
and a molecular weight of 370.24 g/mol. Its IUPAC name is benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium.
Molecular Properties
| Compound Name | benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium |
| PubChem CID | 162437723 |
| Molecular Formula | C17H17N2O2Y- |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium |
| SMILES | O=C(NC1CC[N-]C1=O)c1ccccc1.[Y].c1ccccc1 |
| InChI | InChI=1S/C11H12N2O2.C6H6.Y/c14-10(8-4-2-1-3-5-8)13-9-6-7-12-11(9)15;1-2-4-6-5-3-1;/h1-5,9H,6-7H2,(H2,12,13,14,15);1-6H;/p-1 |
| InChIKey | VWCLYGWTLUBBMN-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium?
The IUPAC name of benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium (CID 162437723) is benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium.
What is the SMILES notation for benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium?
The canonical SMILES for benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium is O=C(NC1CC[N-]C1=O)c1ccccc1.[Y].c1ccccc1.
What is the InChIKey of benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium?
The InChIKey is VWCLYGWTLUBBMN-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H12N2O2.C6H6.Y/c14-10(8-4-2-1-3-5-8)13-9-6-7-12-11(9)15;1-2-4-6-5-3-1;/h1-5,9H,6-7H2,(H2,12,13,14,15);1-6H;/p-1.
What are the key properties of benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium?
benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium has a molecular weight of 370.24 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N-(2-oxopyrrolidin-1-id-3-yl)benzamide;yttrium is sourced from PubChem (CID 162437723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).