C17H15N2O2Y- — CID 169319293
N-[(3S,4R)-2-oxo-4-phenylpyrrolidin-1-id-3-yl]benzamide;yttrium (PubChem CID 169319293) has the molecular formula C17H15N2O2Y- and a molecular weight of 368.23 g/mol. Its IUPAC name is N-[(3S,4R)-2-oxo-4-phenylpyrrolidin-1-id-3-yl]benzamide;yttrium.
| Compound Name | N-[(3S,4R)-2-oxo-4-phenylpyrrolidin-1-id-3-yl]benzamide;yttrium |
|---|---|
| PubChem CID | 169319293 |
| Molecular Formula | C17H15N2O2Y- |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | N-[(3S,4R)-2-oxo-4-phenylpyrrolidin-1-id-3-yl]benzamide;yttrium |
| SMILES | O=C(N[C@@H]1C(=O)[N-]C[C@H]1c1ccccc1)c1ccccc1.[Y] |
| InChI | InChI=1S/C17H16N2O2.Y/c20-16(13-9-5-2-6-10-13)19-15-14(11-18-17(15)21)12-7-3-1-4-8-12;/h1-10,14-15H,11H2,(H2,18,19,20,21);/p-1/t14-,15-;/m0./s1 |
| InChIKey | GHPGAKADPJXHEK-YYLIZZNMSA-M |
| XLogP | 2.48 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |