C19H22N2O — CID 125468545
N'-[(1R,2S)-2-phenylcyclohexyl]benzohydrazide (PubChem CID 125468545) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is N'-[(1R,2S)-2-phenylcyclohexyl]benzohydrazide.
| Compound Name | N'-[(1R,2S)-2-phenylcyclohexyl]benzohydrazide |
|---|---|
| PubChem CID | 125468545 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N'-[(1R,2S)-2-phenylcyclohexyl]benzohydrazide |
| SMILES | O=C(NN[C@@H]1CCCC[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c22-19(16-11-5-2-6-12-16)21-20-18-14-8-7-13-17(18)15-9-3-1-4-10-15/h1-6,9-12,17-18,20H,7-8,13-14H2,(H,21,22)/t17-,18+/m0/s1 |
| InChIKey | NWEGMFWSFUPIKN-ZWKOTPCHSA-N |
| XLogP | 3.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|