C18H25NO — CID 67394032
N-[(1S,2S)-2-phenylcyclopentyl]cyclohexanecarboxamide (PubChem CID 67394032) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[(1S,2S)-2-phenylcyclopentyl]cyclohexanecarboxamide.
| Compound Name | N-[(1S,2S)-2-phenylcyclopentyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 67394032 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | N-[(1S,2S)-2-phenylcyclopentyl]cyclohexanecarboxamide |
| SMILES | O=C(N[C@H]1CCC[C@H]1c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H25NO/c20-18(15-10-5-2-6-11-15)19-17-13-7-12-16(17)14-8-3-1-4-9-14/h1,3-4,8-9,15-17H,2,5-7,10-13H2,(H,19,20)/t16-,17-/m0/s1 |
| InChIKey | HSNYKVFJZGGZOE-IRXDYDNUSA-N |
| XLogP | 4.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |