C12H16N2S — CID 54152607
[(1R,2R)-2-phenylcyclopentyl]thiourea (PubChem CID 54152607) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is [(1R,2R)-2-phenylcyclopentyl]thiourea.
| Compound Name | [(1R,2R)-2-phenylcyclopentyl]thiourea |
|---|---|
| PubChem CID | 54152607 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | [(1R,2R)-2-phenylcyclopentyl]thiourea |
| SMILES | NC(=S)N[C@@H]1CCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C12H16N2S/c13-12(15)14-11-8-4-7-10(11)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8H2,(H3,13,14,15)/t10-,11-/m1/s1 |
| InChIKey | OITWGAXKGWYLKN-GHMZBOCLSA-N |
| XLogP | 2.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|