C19H26N2O3 — CID 122001828
4-[(2-phenylcyclopentyl)carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122001828) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-[(2-phenylcyclopentyl)carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-phenylcyclopentyl)carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122001828 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 4-[(2-phenylcyclopentyl)carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NC1CCC(C(=O)O)CC1)NC1CCCC1c1ccccc1 |
| InChI | InChI=1S/C19H26N2O3/c22-18(23)14-9-11-15(12-10-14)20-19(24)21-17-8-4-7-16(17)13-5-2-1-3-6-13/h1-3,5-6,14-17H,4,7-12H2,(H,22,23)(H2,20,21,24) |
| InChIKey | KDJMRQPEDHFBET-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |