C17H24N2O — CID 129440770
N'-[(2R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzohydrazide (PubChem CID 129440770) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N'-[(2R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzohydrazide.
| Compound Name | N'-[(2R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzohydrazide |
|---|---|
| PubChem CID | 129440770 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N'-[(2R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzohydrazide |
| SMILES | O=C(NN[C@@H]1CC[C@H]2CCCC[C@H]2C1)c1ccccc1 |
| InChI | InChI=1S/C17H24N2O/c20-17(14-7-2-1-3-8-14)19-18-16-11-10-13-6-4-5-9-15(13)12-16/h1-3,7-8,13,15-16,18H,4-6,9-12H2,(H,19,20)/t13-,15+,16-/m1/s1 |
| InChIKey | VNLZOQDWYMYSGP-VNQPRFMTSA-N |
| XLogP | 3.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|