About N-(oxan-2-yl)benzamide
N-(oxan-2-yl)benzamide (PubChem CID 3717262) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is N-(oxan-2-yl)benzamide.
Molecular Properties
| Compound Name | N-(oxan-2-yl)benzamide |
| PubChem CID | 3717262 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-(oxan-2-yl)benzamide |
| SMILES | O=C(NC1CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c14-12(10-6-2-1-3-7-10)13-11-8-4-5-9-15-11/h1-3,6-7,11H,4-5,8-9H2,(H,13,14) |
| InChIKey | ACJOIWBNYDPODS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(oxan-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxan-2-yl)benzamide?
The IUPAC name of N-(oxan-2-yl)benzamide (CID 3717262) is N-(oxan-2-yl)benzamide.
What is the SMILES notation for N-(oxan-2-yl)benzamide?
The canonical SMILES for N-(oxan-2-yl)benzamide is O=C(NC1CCCCO1)c1ccccc1.
What is the InChIKey of N-(oxan-2-yl)benzamide?
The InChIKey is ACJOIWBNYDPODS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c14-12(10-6-2-1-3-7-10)13-11-8-4-5-9-15-11/h1-3,6-7,11H,4-5,8-9H2,(H,13,14).
What are the key properties of N-(oxan-2-yl)benzamide?
N-(oxan-2-yl)benzamide has a molecular weight of 205.26 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxan-2-yl)benzamide is sourced from PubChem (CID 3717262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).