C13H16NO — CID 162397475
CID 162397475 (PubChem CID 162397475) has the molecular formula C13H16NO and a molecular weight of 202.28 g/mol.
| Compound Name | CID 162397475 |
|---|---|
| PubChem CID | 162397475 |
| Molecular Formula | C13H16NO |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | — |
| SMILES | O=C(N[C@H]1[CH]CCCC1)c1ccccc1 |
| InChI | InChI=1S/C13H16NO/c15-13(11-7-3-1-4-8-11)14-12-9-5-2-6-10-12/h1,3-4,7-9,12H,2,5-6,10H2,(H,14,15)/t12-/m0/s1 |
| InChIKey | YSISPEIAWSTEKK-LBPRGKRZSA-N |
| XLogP | 2.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |